C22H19F3N2O — CID 175986266
N-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]benzamide (PubChem CID 175986266) has the molecular formula C22H19F3N2O and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]benzamide.
| Compound Name | N-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 175986266 |
| Molecular Formula | C22H19F3N2O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]benzamide |
| SMILES | Cc1cc(NCc2ccc(C(F)(F)F)cc2)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19F3N2O/c1-15-13-19(26-14-16-7-9-18(10-8-16)22(23,24)25)11-12-20(15)27-21(28)17-5-3-2-4-6-17/h2-13,26H,14H2,1H3,(H,27,28) |
| InChIKey | BMJNOZGOHKDHAT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |