C13H13F3N4 — CID 11778514
6-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2,3,6-triamine (PubChem CID 11778514) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 6-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 11778514 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(NCc2ccc(C(F)(F)F)cc2)nc1N |
| InChI | InChI=1S/C13H13F3N4/c14-13(15,16)9-3-1-8(2-4-9)7-19-11-6-5-10(17)12(18)20-11/h1-6H,7,17H2,(H3,18,19,20) |
| InChIKey | GPJVBBSYOYOUOA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |