C10H12N4S — CID 79827377
6-N-(thiophen-3-ylmethyl)pyridine-2,3,6-triamine (PubChem CID 79827377) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 6-N-(thiophen-3-ylmethyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(thiophen-3-ylmethyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79827377 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 6-N-(thiophen-3-ylmethyl)pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(NCc2ccsc2)nc1N |
| InChI | InChI=1S/C10H12N4S/c11-8-1-2-9(14-10(8)12)13-5-7-3-4-15-6-7/h1-4,6H,5,11H2,(H3,12,13,14) |
| InChIKey | QGXCSAYSKYTGJW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |