C12H14N4O — CID 10036825
2-[[(5,6-diamino-2-pyridinyl)amino]methyl]phenol (PubChem CID 10036825) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-[[(5,6-diamino-2-pyridinyl)amino]methyl]phenol.
| Compound Name | 2-[[(5,6-diamino-2-pyridinyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 10036825 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-[[(5,6-diamino-2-pyridinyl)amino]methyl]phenol |
| SMILES | Nc1ccc(NCc2ccccc2O)nc1N |
| InChI | InChI=1S/C12H14N4O/c13-9-5-6-11(16-12(9)14)15-7-8-3-1-2-4-10(8)17/h1-6,17H,7,13H2,(H3,14,15,16) |
| InChIKey | MMSJWZDPFXCNJS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|