C11H10BrN3O — CID 53250722
2-[[(6-bromopyrazin-2-yl)amino]methyl]phenol (PubChem CID 53250722) has the molecular formula C11H10BrN3O and a molecular weight of 280.12 g/mol. Its IUPAC name is 2-[[(6-bromopyrazin-2-yl)amino]methyl]phenol.
| Compound Name | 2-[[(6-bromopyrazin-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 53250722 |
| Molecular Formula | C11H10BrN3O |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-[[(6-bromopyrazin-2-yl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CNc1cncc(Br)n1 |
| InChI | InChI=1S/C11H10BrN3O/c12-10-6-13-7-11(15-10)14-5-8-3-1-2-4-9(8)16/h1-4,6-7,16H,5H2,(H,14,15) |
| InChIKey | OAEVXBDAPAACDU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|