C9H8BrN3OS — CID 103911742
2-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]phenol (PubChem CID 103911742) has the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. Its IUPAC name is 2-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]phenol.
| Compound Name | 2-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 103911742 |
| Molecular Formula | C9H8BrN3OS |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 2-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CNc1nnc(Br)s1 |
| InChI | InChI=1S/C9H8BrN3OS/c10-8-12-13-9(15-8)11-5-6-3-1-2-4-7(6)14/h1-4,14H,5H2,(H,11,13) |
| InChIKey | DSGSTYDAFXFVII-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|