C26H26BrClN4O3 — CID 162150441
2-[[(6-bromo-4-methyl-2-pyridinyl)amino]methyl]phenol;2-[[(6-chloro-4-methoxy-2-pyridinyl)amino]methyl]phenol (PubChem CID 162150441) has the molecular formula C26H26BrClN4O3 and a molecular weight of 557.88 g/mol. Its IUPAC name is 2-[[(6-bromo-4-methyl-2-pyridinyl)amino]methyl]phenol;2-[[(6-chloro-4-methoxy-2-pyridinyl)amino]methyl]phenol.
| Compound Name | 2-[[(6-bromo-4-methyl-2-pyridinyl)amino]methyl]phenol;2-[[(6-chloro-4-methoxy-2-pyridinyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 162150441 |
| Molecular Formula | C26H26BrClN4O3 |
| Molecular Weight | 557.88 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | 2-[[(6-bromo-4-methyl-2-pyridinyl)amino]methyl]phenol;2-[[(6-chloro-4-methoxy-2-pyridinyl)amino]methyl]phenol |
| SMILES | COc1cc(Cl)nc(NCc2ccccc2O)c1.Cc1cc(Br)nc(NCc2ccccc2O)c1 |
| InChI | InChI=1S/C13H13BrN2O.C13H13ClN2O2/c1-9-6-12(14)16-13(7-9)15-8-10-4-2-3-5-11(10)17;1-18-10-6-12(14)16-13(7-10)15-8-9-4-2-3-5-11(9)17/h2-7,17H,8H2,1H3,(H,15,16);2-7,17H,8H2,1H3,(H,15,16) |
| InChIKey | ZLDFBPGZLXNPHI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.88 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|