C27H27BrClFN4O4 — CID 158892707
2-[[(2-bromo-6-methoxy-4-pyridinyl)amino]methyl]-5-methylphenol;2-[[(2-chloro-6-methoxy-4-pyridinyl)amino]methyl]-4-fluorophenol (PubChem CID 158892707) has the molecular formula C27H27BrClFN4O4 and a molecular weight of 605.89 g/mol. Its IUPAC name is 2-[[(2-bromo-6-methoxy-4-pyridinyl)amino]methyl]-5-methylphenol;2-[[(2-chloro-6-methoxy-4-pyridinyl)amino]methyl]-4-fluorophenol.
| Compound Name | 2-[[(2-bromo-6-methoxy-4-pyridinyl)amino]methyl]-5-methylphenol;2-[[(2-chloro-6-methoxy-4-pyridinyl)amino]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 158892707 |
| Molecular Formula | C27H27BrClFN4O4 |
| Molecular Weight | 605.89 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | 2-[[(2-bromo-6-methoxy-4-pyridinyl)amino]methyl]-5-methylphenol;2-[[(2-chloro-6-methoxy-4-pyridinyl)amino]methyl]-4-fluorophenol |
| SMILES | COc1cc(NCc2cc(F)ccc2O)cc(Cl)n1.COc1cc(NCc2ccc(C)cc2O)cc(Br)n1 |
| InChI | InChI=1S/C14H15BrN2O2.C13H12ClFN2O2/c1-9-3-4-10(12(18)5-9)8-16-11-6-13(15)17-14(7-11)19-2;1-19-13-6-10(5-12(14)17-13)16-7-8-4-9(15)2-3-11(8)18/h3-7,18H,8H2,1-2H3,(H,16,17);2-6,18H,7H2,1H3,(H,16,17) |
| InChIKey | JELAMUPJYZTRML-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.89 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|