C13H13BrFN3O2 — CID 115354999
N-[(2-bromo-5-fluorophenyl)methyl]-4,6-dimethoxypyrimidin-2-amine (PubChem CID 115354999) has the molecular formula C13H13BrFN3O2 and a molecular weight of 342.17 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115354999 |
| Molecular Formula | C13H13BrFN3O2 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NCc2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C13H13BrFN3O2/c1-19-11-6-12(20-2)18-13(17-11)16-7-8-5-9(15)3-4-10(8)14/h3-6H,7H2,1-2H3,(H,16,17,18) |
| InChIKey | JVSSJAKUVYTWKQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |