C12H10Br2FN3 — CID 106193594
6-bromo-N-[(2-bromo-5-fluorophenyl)methyl]-2-methylpyrimidin-4-amine (PubChem CID 106193594) has the molecular formula C12H10Br2FN3 and a molecular weight of 375.04 g/mol. Its IUPAC name is 6-bromo-N-[(2-bromo-5-fluorophenyl)methyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-bromo-N-[(2-bromo-5-fluorophenyl)methyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106193594 |
| Molecular Formula | C12H10Br2FN3 |
| Molecular Weight | 375.04 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | 6-bromo-N-[(2-bromo-5-fluorophenyl)methyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(Br)cc(NCc2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C12H10Br2FN3/c1-7-17-11(14)5-12(18-7)16-6-8-4-9(15)2-3-10(8)13/h2-5H,6H2,1H3,(H,16,17,18) |
| InChIKey | YKPVYPRXSDCWGB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |