C13H13BrFN3O — CID 66325616
N-[(2-bromo-5-fluorophenyl)methyl]-6-methoxy-5-methylpyrimidin-4-amine (PubChem CID 66325616) has the molecular formula C13H13BrFN3O and a molecular weight of 326.17 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-6-methoxy-5-methylpyrimidin-4-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-6-methoxy-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66325616 |
| Molecular Formula | C13H13BrFN3O |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-6-methoxy-5-methylpyrimidin-4-amine |
| SMILES | COc1ncnc(NCc2cc(F)ccc2Br)c1C |
| InChI | InChI=1S/C13H13BrFN3O/c1-8-12(17-7-18-13(8)19-2)16-6-9-5-10(15)3-4-11(9)14/h3-5,7H,6H2,1-2H3,(H,16,17,18) |
| InChIKey | YBMJWBBVQFXFLU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |