C10H18N4O — CID 115358122
3-[(5,6-diamino-2-pyridinyl)amino]-2,2-dimethylpropan-1-ol (PubChem CID 115358122) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-[(5,6-diamino-2-pyridinyl)amino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[(5,6-diamino-2-pyridinyl)amino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115358122 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-[(5,6-diamino-2-pyridinyl)amino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C10H18N4O/c1-10(2,6-15)5-13-8-4-3-7(11)9(12)14-8/h3-4,15H,5-6,11H2,1-2H3,(H3,12,13,14) |
| InChIKey | FKZVGGYDQXHYFA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |