C14H25N3O2 — CID 106141224
5-[(5-amino-6-ethoxy-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 106141224) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-[(5-amino-6-ethoxy-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(5-amino-6-ethoxy-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106141224 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 5-[(5-amino-6-ethoxy-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CCOc1nc(NCC(C)(C)CCCO)ccc1N |
| InChI | InChI=1S/C14H25N3O2/c1-4-19-13-11(15)6-7-12(17-13)16-10-14(2,3)8-5-9-18/h6-7,18H,4-5,8-10,15H2,1-3H3,(H,16,17) |
| InChIKey | LNWUMKIWLRNOOG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |