About 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine
6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine (PubChem CID 130608285) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine.
Molecular Properties
| Compound Name | 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine |
| PubChem CID | 130608285 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine |
| SMILES | C=C(CC)CNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C10H16N4/c1-3-7(2)6-13-9-5-4-8(11)10(12)14-9/h4-5H,2-3,6,11H2,1H3,(H3,12,13,14) |
| InChIKey | DLDGTKRMMIPIMI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine?
The IUPAC name of 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine (CID 130608285) is 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine.
What is the SMILES notation for 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine?
The canonical SMILES for 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine is C=C(CC)CNc1ccc(N)c(N)n1.
What is the InChIKey of 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine?
The InChIKey is DLDGTKRMMIPIMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-3-7(2)6-13-9-5-4-8(11)10(12)14-9/h4-5H,2-3,6,11H2,1H3,(H3,12,13,14).
What are the key properties of 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine?
6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine has a molecular weight of 192.27 g/mol, XLogP of 1.62, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(2-methylidenebutyl)pyridine-2,3,6-triamine is sourced from PubChem (CID 130608285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).