C8H13N5O2 — CID 83201893
2-[(5,6-diamino-2-pyridinyl)amino]ethyl carbamate (PubChem CID 83201893) has the molecular formula C8H13N5O2 and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-[(5,6-diamino-2-pyridinyl)amino]ethyl carbamate.
| Compound Name | 2-[(5,6-diamino-2-pyridinyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83201893 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-[(5,6-diamino-2-pyridinyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C8H13N5O2/c9-5-1-2-6(13-7(5)10)12-3-4-15-8(11)14/h1-2H,3-4,9H2,(H2,11,14)(H3,10,12,13) |
| InChIKey | FUYUZGGOCXNCRF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|