C12H19N5O — CID 79825438
N-cyclopropyl-4-[(5,6-diamino-2-pyridinyl)amino]butanamide (PubChem CID 79825438) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is N-cyclopropyl-4-[(5,6-diamino-2-pyridinyl)amino]butanamide.
| Compound Name | N-cyclopropyl-4-[(5,6-diamino-2-pyridinyl)amino]butanamide |
|---|---|
| PubChem CID | 79825438 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-cyclopropyl-4-[(5,6-diamino-2-pyridinyl)amino]butanamide |
| SMILES | Nc1ccc(NCCCC(=O)NC2CC2)nc1N |
| InChI | InChI=1S/C12H19N5O/c13-9-5-6-10(17-12(9)14)15-7-1-2-11(18)16-8-3-4-8/h5-6,8H,1-4,7,13H2,(H,16,18)(H3,14,15,17) |
| InChIKey | ZLFGQVXUEOQVPM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|