C8H15N5O2S — CID 79826427
N-[2-[(5,6-diamino-2-pyridinyl)amino]ethyl]methanesulfonamide (PubChem CID 79826427) has the molecular formula C8H15N5O2S and a molecular weight of 245.31 g/mol. Its IUPAC name is N-[2-[(5,6-diamino-2-pyridinyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(5,6-diamino-2-pyridinyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 79826427 |
| Molecular Formula | C8H15N5O2S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-[2-[(5,6-diamino-2-pyridinyl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C8H15N5O2S/c1-16(14,15)12-5-4-11-7-3-2-6(9)8(10)13-7/h2-3,12H,4-5,9H2,1H3,(H3,10,11,13) |
| InChIKey | WAPNEUCIMYCSDZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|