C10H15N5O3 — CID 83203413
2-[[6-(dimethylcarbamoyl)pyridazin-3-yl]amino]ethyl carbamate (PubChem CID 83203413) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[[6-(dimethylcarbamoyl)pyridazin-3-yl]amino]ethyl carbamate.
| Compound Name | 2-[[6-(dimethylcarbamoyl)pyridazin-3-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203413 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[[6-(dimethylcarbamoyl)pyridazin-3-yl]amino]ethyl carbamate |
| SMILES | CN(C)C(=O)c1ccc(NCCOC(N)=O)nn1 |
| InChI | InChI=1S/C10H15N5O3/c1-15(2)9(16)7-3-4-8(14-13-7)12-5-6-18-10(11)17/h3-4H,5-6H2,1-2H3,(H2,11,17)(H,12,14) |
| InChIKey | ZBXPRNRECAXTQM-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|