C10H16N6O2 — CID 83114171
6-[2-(carbamoylamino)ethylamino]-N,N-dimethylpyridazine-3-carboxamide (PubChem CID 83114171) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 6-[2-(carbamoylamino)ethylamino]-N,N-dimethylpyridazine-3-carboxamide.
| Compound Name | 6-[2-(carbamoylamino)ethylamino]-N,N-dimethylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 83114171 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 6-[2-(carbamoylamino)ethylamino]-N,N-dimethylpyridazine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NCCNC(N)=O)nn1 |
| InChI | InChI=1S/C10H16N6O2/c1-16(2)9(17)7-3-4-8(15-14-7)12-5-6-13-10(11)18/h3-4H,5-6H2,1-2H3,(H,12,15)(H3,11,13,18) |
| InChIKey | FVRYBQZXPOKICL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|