C13H24N6O — CID 109115146
N-[2-(dimethylamino)ethyl]-6-[2-(dimethylamino)ethylamino]pyridazine-3-carboxamide (PubChem CID 109115146) has the molecular formula C13H24N6O and a molecular weight of 280.38 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-[2-(dimethylamino)ethylamino]pyridazine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-[2-(dimethylamino)ethylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109115146 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-[2-(dimethylamino)ethylamino]pyridazine-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc(NCCN(C)C)nn1 |
| InChI | InChI=1S/C13H24N6O/c1-18(2)9-7-14-12-6-5-11(16-17-12)13(20)15-8-10-19(3)4/h5-6H,7-10H2,1-4H3,(H,14,17)(H,15,20) |
| InChIKey | SQCKYLISLNVIGZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |