C15H18FN5O — CID 109115425
N-[2-(dimethylamino)ethyl]-6-(4-fluoroanilino)pyridazine-3-carboxamide (PubChem CID 109115425) has the molecular formula C15H18FN5O and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-(4-fluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-(4-fluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109115425 |
| Molecular Formula | C15H18FN5O |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-(4-fluoroanilino)pyridazine-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc(Nc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C15H18FN5O/c1-21(2)10-9-17-15(22)13-7-8-14(20-19-13)18-12-5-3-11(16)4-6-12/h3-8H,9-10H2,1-2H3,(H,17,22)(H,18,20) |
| InChIKey | CZAICUNECNNZPJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |