C16H20FN5O — CID 109116042
N-[3-(dimethylamino)propyl]-6-(2-fluoroanilino)pyridazine-3-carboxamide (PubChem CID 109116042) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-(2-fluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-(2-fluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109116042 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-(2-fluoroanilino)pyridazine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(Nc2ccccc2F)nn1 |
| InChI | InChI=1S/C16H20FN5O/c1-22(2)11-5-10-18-16(23)14-8-9-15(21-20-14)19-13-7-4-3-6-12(13)17/h3-4,6-9H,5,10-11H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | WJOQHLPBJSJJQN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|