C19H27N5O — CID 109116034
N-[3-(dimethylamino)propyl]-6-(2-ethyl-6-methylanilino)pyridazine-3-carboxamide (PubChem CID 109116034) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-(2-ethyl-6-methylanilino)pyridazine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-(2-ethyl-6-methylanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109116034 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-(2-ethyl-6-methylanilino)pyridazine-3-carboxamide |
| SMILES | CCc1cccc(C)c1Nc1ccc(C(=O)NCCCN(C)C)nn1 |
| InChI | InChI=1S/C19H27N5O/c1-5-15-9-6-8-14(2)18(15)21-17-11-10-16(22-23-17)19(25)20-12-7-13-24(3)4/h6,8-11H,5,7,12-13H2,1-4H3,(H,20,25)(H,21,23) |
| InChIKey | RHHMSNIPQMUXOR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|