C7H11N5O — CID 62236767
6-hydrazinyl-N,N-dimethylpyridazine-3-carboxamide (PubChem CID 62236767) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-dimethylpyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N,N-dimethylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62236767 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 6-hydrazinyl-N,N-dimethylpyridazine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C7H11N5O/c1-12(2)7(13)5-3-4-6(9-8)11-10-5/h3-4H,8H2,1-2H3,(H,9,11) |
| InChIKey | WIJWBFFCDSMGRE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|