C12H21N5O — CID 62237902
N-(3,3-dimethylbutan-2-yl)-6-hydrazinyl-N-methylpyridazine-3-carboxamide (PubChem CID 62237902) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-6-hydrazinyl-N-methylpyridazine-3-carboxamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-6-hydrazinyl-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62237902 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-6-hydrazinyl-N-methylpyridazine-3-carboxamide |
| SMILES | CC(N(C)C(=O)c1ccc(NN)nn1)C(C)(C)C |
| InChI | InChI=1S/C12H21N5O/c1-8(12(2,3)4)17(5)11(18)9-6-7-10(14-13)16-15-9/h6-8H,13H2,1-5H3,(H,14,16) |
| InChIKey | LJVBVPLBVQKIPQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|