C13H23N5O — CID 55052509
6-hydrazinyl-N,N-bis(2-methylpropyl)pyridazine-3-carboxamide (PubChem CID 55052509) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-bis(2-methylpropyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N,N-bis(2-methylpropyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55052509 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 6-hydrazinyl-N,N-bis(2-methylpropyl)pyridazine-3-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C13H23N5O/c1-9(2)7-18(8-10(3)4)13(19)11-5-6-12(15-14)17-16-11/h5-6,9-10H,7-8,14H2,1-4H3,(H,15,17) |
| InChIKey | HBPDQGXGUCZXNA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|