C10H14N6O — CID 62248946
N-(2-cyanoethyl)-N-ethyl-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 62248946) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-ethyl-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-ethyl-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62248946 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(2-cyanoethyl)-N-ethyl-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | CCN(CCC#N)C(=O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C10H14N6O/c1-2-16(7-3-6-11)10(17)8-4-5-9(13-12)15-14-8/h4-5H,2-3,7,12H2,1H3,(H,13,15) |
| InChIKey | MIEQHPMWYWCTKC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|