C10H13N5O — CID 107375045
5-amino-N-(2-cyanoethyl)-N-ethylpyrazine-2-carboxamide (PubChem CID 107375045) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 5-amino-N-(2-cyanoethyl)-N-ethylpyrazine-2-carboxamide.
| Compound Name | 5-amino-N-(2-cyanoethyl)-N-ethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107375045 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5-amino-N-(2-cyanoethyl)-N-ethylpyrazine-2-carboxamide |
| SMILES | CCN(CCC#N)C(=O)c1cnc(N)cn1 |
| InChI | InChI=1S/C10H13N5O/c1-2-15(5-3-4-11)10(16)8-6-14-9(12)7-13-8/h6-7H,2-3,5H2,1H3,(H2,12,14) |
| InChIKey | XXEUVJXLNUFKAR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |