C11H10ClN5O — CID 107371836
5-chloro-N,N-bis(2-cyanoethyl)pyrazine-2-carboxamide (PubChem CID 107371836) has the molecular formula C11H10ClN5O and a molecular weight of 263.69 g/mol. Its IUPAC name is 5-chloro-N,N-bis(2-cyanoethyl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N,N-bis(2-cyanoethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107371836 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-chloro-N,N-bis(2-cyanoethyl)pyrazine-2-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C11H10ClN5O/c12-10-8-15-9(7-16-10)11(18)17(5-1-3-13)6-2-4-14/h7-8H,1-2,5-6H2 |
| InChIKey | DWFGLNMITDIQBA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |