C11H14N4O — CID 62161601
2-amino-N-(2-cyanoethyl)-N-ethylpyridine-3-carboxamide (PubChem CID 62161601) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-N-ethylpyridine-3-carboxamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-N-ethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62161601 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-N-ethylpyridine-3-carboxamide |
| SMILES | CCN(CCC#N)C(=O)c1cccnc1N |
| InChI | InChI=1S/C11H14N4O/c1-2-15(8-4-6-12)11(16)9-5-3-7-14-10(9)13/h3,5,7H,2,4,8H2,1H3,(H2,13,14) |
| InChIKey | RZOQOCZSBGAEEY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |