C9H12F3N5O2 — CID 107486329
6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide (PubChem CID 107486329) has the molecular formula C9H12F3N5O2 and a molecular weight of 279.22 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107486329 |
| Molecular Formula | C9H12F3N5O2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-hydrazinyl-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)N(CCO)CC(F)(F)F)nn1 |
| InChI | InChI=1S/C9H12F3N5O2/c10-9(11,12)5-17(3-4-18)8(19)6-1-2-7(14-13)16-15-6/h1-2,18H,3-5,13H2,(H,14,16) |
| InChIKey | DMPKVFOZFJQHIT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|