C9H12N8O — CID 64519120
6-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridazine-3-carboxamide (PubChem CID 64519120) has the molecular formula C9H12N8O and a molecular weight of 248.25 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 64519120 |
| Molecular Formula | C9H12N8O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridazine-3-carboxamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C9H12N8O/c1-17(4-8-11-5-12-15-8)9(18)6-2-3-7(13-10)16-14-6/h2-3,5H,4,10H2,1H3,(H,13,16)(H,11,12,15) |
| InChIKey | ZRZYBIUWNOLCTI-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|