C10H14N8O — CID 64524982
6-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridazine-3-carboxamide (PubChem CID 64524982) has the molecular formula C10H14N8O and a molecular weight of 262.28 g/mol. Its IUPAC name is 6-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 64524982 |
| Molecular Formula | C10H14N8O |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 6-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCCCc2ncn[nH]2)nn1 |
| InChI | InChI=1S/C10H14N8O/c11-15-9-4-3-7(16-18-9)10(19)12-5-1-2-8-13-6-14-17-8/h3-4,6H,1-2,5,11H2,(H,12,19)(H,15,18)(H,13,14,17) |
| InChIKey | TZZICIIZTDIFAQ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|