C12H13F2N5O — CID 64518550
2-amino-4,5-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide (PubChem CID 64518550) has the molecular formula C12H13F2N5O and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-amino-4,5-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide.
| Compound Name | 2-amino-4,5-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 64518550 |
| Molecular Formula | C12H13F2N5O |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-amino-4,5-difluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
| SMILES | Nc1cc(F)c(F)cc1C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H13F2N5O/c13-8-4-7(10(15)5-9(8)14)12(20)16-3-1-2-11-17-6-18-19-11/h4-6H,1-3,15H2,(H,16,20)(H,17,18,19) |
| InChIKey | JWGFAQMHNIGNCP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|