C12H12BrFN4O — CID 64545931
2-bromo-5-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide (PubChem CID 64545931) has the molecular formula C12H12BrFN4O and a molecular weight of 327.16 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide.
| Compound Name | 2-bromo-5-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 64545931 |
| Molecular Formula | C12H12BrFN4O |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-bromo-5-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C12H12BrFN4O/c13-10-4-3-8(14)6-9(10)12(19)15-5-1-2-11-16-7-17-18-11/h3-4,6-7H,1-2,5H2,(H,15,19)(H,16,17,18) |
| InChIKey | OMKBWLAGTYYERW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|