C11H11F2N5O — CID 107121133
3-amino-2,5-difluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 107121133) has the molecular formula C11H11F2N5O and a molecular weight of 267.24 g/mol. Its IUPAC name is 3-amino-2,5-difluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 3-amino-2,5-difluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107121133 |
| Molecular Formula | C11H11F2N5O |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-amino-2,5-difluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | Nc1cc(F)cc(C(=O)NCCc2ncn[nH]2)c1F |
| InChI | InChI=1S/C11H11F2N5O/c12-6-3-7(10(13)8(14)4-6)11(19)15-2-1-9-16-5-17-18-9/h3-5H,1-2,14H2,(H,15,19)(H,16,17,18) |
| InChIKey | VMZOMEZIACPAIZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|