C11H11FN4O2 — CID 104919903
2-fluoro-6-hydroxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 104919903) has the molecular formula C11H11FN4O2 and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-fluoro-6-hydroxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 2-fluoro-6-hydroxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 104919903 |
| Molecular Formula | C11H11FN4O2 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-fluoro-6-hydroxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ncn[nH]1)c1c(O)cccc1F |
| InChI | InChI=1S/C11H11FN4O2/c12-7-2-1-3-8(17)10(7)11(18)13-5-4-9-14-6-15-16-9/h1-3,6,17H,4-5H2,(H,13,18)(H,14,15,16) |
| InChIKey | PDNTYLZUUFGNDR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |