C9H12N8O — CID 106283109
6-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridazine-3-carboxamide (PubChem CID 106283109) has the molecular formula C9H12N8O and a molecular weight of 248.25 g/mol. Its IUPAC name is 6-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 106283109 |
| Molecular Formula | C9H12N8O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridazine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(NN)nn1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H12N8O/c1-5(8-11-4-12-17-8)13-9(18)6-2-3-7(14-10)16-15-6/h2-5H,10H2,1H3,(H,13,18)(H,14,16)(H,11,12,17) |
| InChIKey | IXHGNJBUGDMAJT-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|