C10H13N7O — CID 106283130
5-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide (PubChem CID 106283130) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 5-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106283130 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 5-hydrazinyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(NN)cn1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H13N7O/c1-6(9-13-5-14-17-9)15-10(18)8-3-2-7(16-11)4-12-8/h2-6,16H,11H2,1H3,(H,15,18)(H,13,14,17) |
| InChIKey | QARALGKMKMEYHQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|