C11H12N6OS — CID 106281493
5-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide (PubChem CID 106281493) has the molecular formula C11H12N6OS and a molecular weight of 276.33 g/mol. Its IUPAC name is 5-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106281493 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 5-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(C(N)=S)cn1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12N6OS/c1-6(10-14-5-15-17-10)16-11(18)8-3-2-7(4-13-8)9(12)19/h2-6H,1H3,(H2,12,19)(H,16,18)(H,14,15,17) |
| InChIKey | RLMQVBVKTPOEIH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|