C13H18N4O2S — CID 103110414
5-carbamothioyl-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]pyridine-2-carboxamide (PubChem CID 103110414) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-carbamothioyl-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103110414 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-carbamothioyl-N-[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]pyridine-2-carboxamide |
| SMILES | CCN(C)C(=O)C(C)NC(=O)c1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C13H18N4O2S/c1-4-17(3)13(19)8(2)16-12(18)10-6-5-9(7-15-10)11(14)20/h5-8H,4H2,1-3H3,(H2,14,20)(H,16,18) |
| InChIKey | MMMAHCRIHQWHDF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|