C14H15N3OS2 — CID 63748667
5-carbamothioyl-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-2-carboxamide (PubChem CID 63748667) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 5-carbamothioyl-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63748667 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-carbamothioyl-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(C(N)=S)cn2)s1 |
| InChI | InChI=1S/C14H15N3OS2/c1-8-3-6-12(20-8)9(2)17-14(18)11-5-4-10(7-16-11)13(15)19/h3-7,9H,1-2H3,(H2,15,19)(H,17,18) |
| InChIKey | TYMKVLQYTBNBHD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|