C11H13ClN6O — CID 64519313
5-chloro-2-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 64519313) has the molecular formula C11H13ClN6O and a molecular weight of 280.72 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 5-chloro-2-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 64519313 |
| Molecular Formula | C11H13ClN6O |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)c1cc(Cl)ccc1NN |
| InChI | InChI=1S/C11H13ClN6O/c1-18(5-10-14-6-15-17-10)11(19)8-4-7(12)2-3-9(8)16-13/h2-4,6,16H,5,13H2,1H3,(H,14,15,17) |
| InChIKey | QGSLOQWRDBJDGW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|