C10H9Cl2N5O — CID 64516867
2,6-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-4-carboxamide (PubChem CID 64516867) has the molecular formula C10H9Cl2N5O and a molecular weight of 286.12 g/mol. Its IUPAC name is 2,6-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 64516867 |
| Molecular Formula | C10H9Cl2N5O |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2,6-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-4-carboxamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N5O/c1-17(4-9-13-5-14-16-9)10(18)6-2-7(11)15-8(12)3-6/h2-3,5H,4H2,1H3,(H,13,14,16) |
| InChIKey | KZGDUURQXMBEDD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|