C11H11Cl2N5O — CID 107185300
5-amino-2,3-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 107185300) has the molecular formula C11H11Cl2N5O and a molecular weight of 300.15 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107185300 |
| Molecular Formula | C11H11Cl2N5O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 5-amino-2,3-dichloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2N5O/c1-18(4-9-15-5-16-17-9)11(19)7-2-6(14)3-8(12)10(7)13/h2-3,5H,4,14H2,1H3,(H,15,16,17) |
| InChIKey | LKGXJPPFDQIOFY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|