C12H13Cl2N5O — CID 107185298
5-amino-2,3-dichloro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 107185298) has the molecular formula C12H13Cl2N5O and a molecular weight of 314.18 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107185298 |
| Molecular Formula | C12H13Cl2N5O |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 5-amino-2,3-dichloro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | Cc1nc(CN(C)C(=O)c2cc(N)cc(Cl)c2Cl)n[nH]1 |
| InChI | InChI=1S/C12H13Cl2N5O/c1-6-16-10(18-17-6)5-19(2)12(20)8-3-7(15)4-9(13)11(8)14/h3-4H,5,15H2,1-2H3,(H,16,17,18) |
| InChIKey | XQWQOSASWFLVNN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|