C13H16BrN5O — CID 107872823
3-amino-5-bromo-N,2-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 107872823) has the molecular formula C13H16BrN5O and a molecular weight of 338.21 g/mol. Its IUPAC name is 3-amino-5-bromo-N,2-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 3-amino-5-bromo-N,2-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107872823 |
| Molecular Formula | C13H16BrN5O |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-amino-5-bromo-N,2-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | Cc1nc(CN(C)C(=O)c2cc(Br)cc(N)c2C)n[nH]1 |
| InChI | InChI=1S/C13H16BrN5O/c1-7-10(4-9(14)5-11(7)15)13(20)19(3)6-12-16-8(2)17-18-12/h4-5H,6,15H2,1-3H3,(H,16,17,18) |
| InChIKey | NWNWPXNZVVBQOA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|