C12H12BrIN4O — CID 64512191
5-bromo-2-iodo-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 64512191) has the molecular formula C12H12BrIN4O and a molecular weight of 435.06 g/mol. Its IUPAC name is 5-bromo-2-iodo-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 5-bromo-2-iodo-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 64512191 |
| Molecular Formula | C12H12BrIN4O |
| Molecular Weight | 435.06 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | 5-bromo-2-iodo-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | Cc1nc(CN(C)C(=O)c2cc(Br)ccc2I)n[nH]1 |
| InChI | InChI=1S/C12H12BrIN4O/c1-7-15-11(17-16-7)6-18(2)12(19)9-5-8(13)3-4-10(9)14/h3-5H,6H2,1-2H3,(H,15,16,17) |
| InChIKey | IJHFKOGXTUAFAP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.06 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|