C12H14FN5O — CID 64518342
2-amino-3-fluoro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 64518342) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 2-amino-3-fluoro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 64518342 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-amino-3-fluoro-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | Cc1nc(CN(C)C(=O)c2cccc(F)c2N)n[nH]1 |
| InChI | InChI=1S/C12H14FN5O/c1-7-15-10(17-16-7)6-18(2)12(19)8-4-3-5-9(13)11(8)14/h3-5H,6,14H2,1-2H3,(H,15,16,17) |
| InChIKey | GSAUMIMXULJJPF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|