C12H14FN5O — CID 103296536
5-amino-2-fluoro-N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 103296536) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is 5-amino-2-fluoro-N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 5-amino-2-fluoro-N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103296536 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5-amino-2-fluoro-N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | Cc1cc(N)cc(C(=O)N(C)Cc2ncn[nH]2)c1F |
| InChI | InChI=1S/C12H14FN5O/c1-7-3-8(14)4-9(11(7)13)12(19)18(2)5-10-15-6-16-17-10/h3-4,6H,5,14H2,1-2H3,(H,15,16,17) |
| InChIKey | DFEMYMYVJZVXJK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|